C45H74NO8P — CID 134766290
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9E,11E)-octadeca-9,11-dienoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 134766290) has the molecular formula C45H74NO8P and a molecular weight of 788.06 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9E,11E)-octadeca-9,11-dienoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9E,11E)-octadeca-9,11-dienoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 134766290 |
| Molecular Formula | C45H74NO8P |
| Molecular Weight | 788.06 g/mol |
| Exact Mass | 787.52 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9E,11E)-octadeca-9,11-dienoyl]oxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/C=C/CCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C45H74NO8P/c1-3-5-7-9-11-13-15-17-19-20-21-22-24-26-28-30-32-34-36-38-45(48)54-43(42-53-55(49,50)52-40-39-46)41-51-44(47)37-35-33-31-29-27-25-23-18-16-14-12-10-8-6-4-2/h5,7,11,13-14,16-19,21-23,26,28,32,34,43H,3-4,6,8-10,12,15,20,24-25,27,29-31,33,35-42,46H2,1-2H3,(H,49,50)/b7-5+,13-11+,16-14+,19-17+,22-21+,23-18+,28-26+,34-32+/t43-/m1/s1 |
| InChIKey | SEHGLVURPCUJJM-IFFUAHAMSA-N |
| XLogP | 11.83 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.06 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|