About 5-iodopent-1-enylboronic acid
5-iodopent-1-enylboronic acid (PubChem CID 54539048) has the molecular formula C5H10BIO2
and a molecular weight of 239.85 g/mol. Its IUPAC name is 5-iodopent-1-enylboronic acid.
Molecular Properties
| Compound Name | 5-iodopent-1-enylboronic acid |
| PubChem CID | 54539048 |
| Molecular Formula | C5H10BIO2 |
| Molecular Weight | 239.85 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 5-iodopent-1-enylboronic acid |
| SMILES | OB(O)C=CCCCI |
| InChI | InChI=1S/C5H10BIO2/c7-5-3-1-2-4-6(8)9/h2,4,8-9H,1,3,5H2 |
| InChIKey | ZBVKSCKRJOATIB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.85 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodopent-1-enylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodopent-1-enylboronic acid?
The IUPAC name of 5-iodopent-1-enylboronic acid (CID 54539048) is 5-iodopent-1-enylboronic acid.
What is the SMILES notation for 5-iodopent-1-enylboronic acid?
The canonical SMILES for 5-iodopent-1-enylboronic acid is OB(O)C=CCCCI.
What is the InChIKey of 5-iodopent-1-enylboronic acid?
The InChIKey is ZBVKSCKRJOATIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10BIO2/c7-5-3-1-2-4-6(8)9/h2,4,8-9H,1,3,5H2.
What are the key properties of 5-iodopent-1-enylboronic acid?
5-iodopent-1-enylboronic acid has a molecular weight of 239.85 g/mol, XLogP of 0.77, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodopent-1-enylboronic acid is sourced from PubChem (CID 54539048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).