C15H11FO5S — CID 54539474
2-(7-fluoro-10,10-dioxophenoxathiin-2-yl)propanoic acid (PubChem CID 54539474) has the molecular formula C15H11FO5S and a molecular weight of 322.31 g/mol. Its IUPAC name is 2-(7-fluoro-10,10-dioxophenoxathiin-2-yl)propanoic acid.
| Compound Name | 2-(7-fluoro-10,10-dioxophenoxathiin-2-yl)propanoic acid |
|---|---|
| PubChem CID | 54539474 |
| Molecular Formula | C15H11FO5S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-(7-fluoro-10,10-dioxophenoxathiin-2-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccc2c(c1)S(=O)(=O)c1ccc(F)cc1O2 |
| InChI | InChI=1S/C15H11FO5S/c1-8(15(17)18)9-2-4-11-14(6-9)22(19,20)13-5-3-10(16)7-12(13)21-11/h2-8H,1H3,(H,17,18) |
| InChIKey | ZCCUIJALQORSEM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |