C22H18ClF6NO3 — CID 54540693
trans-[2,2,2-trifluoro-1-(6-phenoxy-2-pyridinyl)ethyl] (1R,3R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54540693) has the molecular formula C22H18ClF6NO3 and a molecular weight of 493.83 g/mol. Its IUPAC name is trans-[2,2,2-trifluoro-1-(6-phenoxy-2-pyridinyl)ethyl] (1R,3R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-[2,2,2-trifluoro-1-(6-phenoxy-2-pyridinyl)ethyl] (1R,3R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54540693 |
| Molecular Formula | C22H18ClF6NO3 |
| Molecular Weight | 493.83 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | trans-[2,2,2-trifluoro-1-(6-phenoxy-2-pyridinyl)ethyl] (1R,3R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OC(c2cccc(Oc3ccccc3)n2)C(F)(F)F)[C@@H]1C=C(Cl)C(F)(F)F |
| InChI | InChI=1S/C22H18ClF6NO3/c1-20(2)13(11-15(23)21(24,25)26)17(20)19(31)33-18(22(27,28)29)14-9-6-10-16(30-14)32-12-7-4-3-5-8-12/h3-11,13,17-18H,1-2H3/t13-,17-,18?/m0/s1 |
| InChIKey | ZCZDZBGYHBHWHW-VELWFJCASA-N |
| XLogP | 6.98 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.83 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |