C21H35N — CID 54541113
2,6-di(cyclooctyl)-2,5-dihydropyridine (PubChem CID 54541113) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is 2,6-di(cyclooctyl)-2,5-dihydropyridine.
| Compound Name | 2,6-di(cyclooctyl)-2,5-dihydropyridine |
|---|---|
| PubChem CID | 54541113 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | 2,6-di(cyclooctyl)-2,5-dihydropyridine |
| SMILES | C1=CC(C2CCCCCCC2)N=C(C2CCCCCCC2)C1 |
| InChI | InChI=1S/C21H35N/c1-3-7-12-18(13-8-4-1)20-16-11-17-21(22-20)19-14-9-5-2-6-10-15-19/h11,16,18-20H,1-10,12-15,17H2 |
| InChIKey | AADOJHINCLRHQO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|