C21H37N — CID 123283756
2-(2,4-dimethyloctyl)-3,6-dimethyl-2,3,4,4a,5,6-hexahydroquinoline (PubChem CID 123283756) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is 2-(2,4-dimethyloctyl)-3,6-dimethyl-2,3,4,4a,5,6-hexahydroquinoline.
| Compound Name | 2-(2,4-dimethyloctyl)-3,6-dimethyl-2,3,4,4a,5,6-hexahydroquinoline |
|---|---|
| PubChem CID | 123283756 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | 2-(2,4-dimethyloctyl)-3,6-dimethyl-2,3,4,4a,5,6-hexahydroquinoline |
| SMILES | CCCCC(C)CC(C)CC1N=C2C=CC(C)CC2CC1C |
| InChI | InChI=1S/C21H37N/c1-6-7-8-15(2)11-17(4)13-21-18(5)14-19-12-16(3)9-10-20(19)22-21/h9-10,15-19,21H,6-8,11-14H2,1-5H3 |
| InChIKey | VTWQQOIWHXXWGJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |