C27H32O8 — CID 54541182
ethyl 6-acetyl-7-[5-(4-acetyl-3-hydroxyphenoxy)pentoxy]-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 54541182) has the molecular formula C27H32O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is ethyl 6-acetyl-7-[5-(4-acetyl-3-hydroxyphenoxy)pentoxy]-3,4-dihydro-2H-chromene-2-carboxylate.
| Compound Name | ethyl 6-acetyl-7-[5-(4-acetyl-3-hydroxyphenoxy)pentoxy]-3,4-dihydro-2H-chromene-2-carboxylate |
|---|---|
| PubChem CID | 54541182 |
| Molecular Formula | C27H32O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | ethyl 6-acetyl-7-[5-(4-acetyl-3-hydroxyphenoxy)pentoxy]-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | CCOC(=O)C1CCc2cc(C(C)=O)c(OCCCCCOc3ccc(C(C)=O)c(O)c3)cc2O1 |
| InChI | InChI=1S/C27H32O8/c1-4-32-27(31)24-11-8-19-14-22(18(3)29)26(16-25(19)35-24)34-13-7-5-6-12-33-20-9-10-21(17(2)28)23(30)15-20/h9-10,14-16,24,30H,4-8,11-13H2,1-3H3 |
| InChIKey | ZDHLCOIKESFNPG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|