C17H11ClN2O5 — CID 5454193
(5Z)-1-(3-chlorophenyl)-5-[(2,4-dihydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 5454193) has the molecular formula C17H11ClN2O5 and a molecular weight of 358.74 g/mol. Its IUPAC name is (5Z)-1-(3-chlorophenyl)-5-[(2,4-dihydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(3-chlorophenyl)-5-[(2,4-dihydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5454193 |
| Molecular Formula | C17H11ClN2O5 |
| Molecular Weight | 358.74 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (5Z)-1-(3-chlorophenyl)-5-[(2,4-dihydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccc(Cl)c2)C(=O)/C1=C\c1ccc(O)cc1O |
| InChI | InChI=1S/C17H11ClN2O5/c18-10-2-1-3-11(7-10)20-16(24)13(15(23)19-17(20)25)6-9-4-5-12(21)8-14(9)22/h1-8,21-22H,(H,19,23,25)/b13-6- |
| InChIKey | RFHBXOGHTUUZGW-MLPAPPSSSA-N |
| XLogP | 2.42 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|