C28H25ClN4O3 — CID 54542138
7-[3-(2-chloroethoxy)phenyl]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 54542138) has the molecular formula C28H25ClN4O3 and a molecular weight of 500.99 g/mol. Its IUPAC name is 7-[3-(2-chloroethoxy)phenyl]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[3-(2-chloroethoxy)phenyl]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 54542138 |
| Molecular Formula | C28H25ClN4O3 |
| Molecular Weight | 500.99 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 7-[3-(2-chloroethoxy)phenyl]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1cc(-c2cn(-c3cccc(OCCCl)c3)c3ncnc(N)c23)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H25ClN4O3/c1-34-25-14-20(10-11-24(25)36-17-19-6-3-2-4-7-19)23-16-33(28-26(23)27(30)31-18-32-28)21-8-5-9-22(15-21)35-13-12-29/h2-11,14-16,18H,12-13,17H2,1H3,(H2,30,31,32) |
| InChIKey | ZDYVJMYUORYACM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.99 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|