C24H23O4P — CID 54542518
diethyl (3-phenanthren-9-ylphenyl) phosphate (PubChem CID 54542518) has the molecular formula C24H23O4P and a molecular weight of 406.42 g/mol. Its IUPAC name is diethyl (3-phenanthren-9-ylphenyl) phosphate.
| Compound Name | diethyl (3-phenanthren-9-ylphenyl) phosphate |
|---|---|
| PubChem CID | 54542518 |
| Molecular Formula | C24H23O4P |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | diethyl (3-phenanthren-9-ylphenyl) phosphate |
| SMILES | CCOP(=O)(OCC)Oc1cccc(-c2cc3ccccc3c3ccccc23)c1 |
| InChI | InChI=1S/C24H23O4P/c1-3-26-29(25,27-4-2)28-20-12-9-11-18(16-20)24-17-19-10-5-6-13-21(19)22-14-7-8-15-23(22)24/h5-17H,3-4H2,1-2H3 |
| InChIKey | ZEFSNLPXFBOICA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|