C16H26ClNO3 — CID 54543546
4-amino-2,2,4-trimethylpentan-1-ol;benzyl carbonochloridate (PubChem CID 54543546) has the molecular formula C16H26ClNO3 and a molecular weight of 315.84 g/mol. Its IUPAC name is 4-amino-2,2,4-trimethylpentan-1-ol;benzyl carbonochloridate.
| Compound Name | 4-amino-2,2,4-trimethylpentan-1-ol;benzyl carbonochloridate |
|---|---|
| PubChem CID | 54543546 |
| Molecular Formula | C16H26ClNO3 |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-amino-2,2,4-trimethylpentan-1-ol;benzyl carbonochloridate |
| SMILES | CC(C)(N)CC(C)(C)CO.O=C(Cl)OCc1ccccc1 |
| InChI | InChI=1S/C8H7ClO2.C8H19NO/c9-8(10)11-6-7-4-2-1-3-5-7;1-7(2,6-10)5-8(3,4)9/h1-5H,6H2;10H,5-6,9H2,1-4H3 |
| InChIKey | ZEYDWUFOOWXYMG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|