C16H20N2O6 — CID 54544180
(3S)-3-formamido-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-methyl-4-oxobutanoic acid (PubChem CID 54544180) has the molecular formula C16H20N2O6 and a molecular weight of 336.34 g/mol. Its IUPAC name is (3S)-3-formamido-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-methyl-4-oxobutanoic acid.
| Compound Name | (3S)-3-formamido-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54544180 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (3S)-3-formamido-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-2-methyl-4-oxobutanoic acid |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC=O)C(C)C(=O)O |
| InChI | InChI=1S/C16H20N2O6/c1-10(15(21)22)13(17-9-19)14(20)18-12(16(23)24-2)8-11-6-4-3-5-7-11/h3-7,9-10,12-13H,8H2,1-2H3,(H,17,19)(H,18,20)(H,21,22)/t10?,12-,13-/m0/s1 |
| InChIKey | ZFJUYCZICTTYFS-OLPBLLBXSA-N |
| XLogP | -0.28 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|