C17H16BrNO2 — CID 54545913
methyl 1-benzyl-5-bromo-2,3-dihydroindole-2-carboxylate (PubChem CID 54545913) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is methyl 1-benzyl-5-bromo-2,3-dihydroindole-2-carboxylate.
| Compound Name | methyl 1-benzyl-5-bromo-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 54545913 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | methyl 1-benzyl-5-bromo-2,3-dihydroindole-2-carboxylate |
| SMILES | COC(=O)C1Cc2cc(Br)ccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C17H16BrNO2/c1-21-17(20)16-10-13-9-14(18)7-8-15(13)19(16)11-12-5-3-2-4-6-12/h2-9,16H,10-11H2,1H3 |
| InChIKey | ZGNBGHDWFXGUJJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |