C24H27ClN4O2 — CID 54546440
N-(5-chloro-2-pyridinyl)-2-[[2-(furan-2-yl)-1-piperidin-4-ylpropyl]amino]benzamide (PubChem CID 54546440) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[2-(furan-2-yl)-1-piperidin-4-ylpropyl]amino]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[2-(furan-2-yl)-1-piperidin-4-ylpropyl]amino]benzamide |
|---|---|
| PubChem CID | 54546440 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[2-(furan-2-yl)-1-piperidin-4-ylpropyl]amino]benzamide |
| SMILES | CC(c1ccco1)C(Nc1ccccc1C(=O)Nc1ccc(Cl)cn1)C1CCNCC1 |
| InChI | InChI=1S/C24H27ClN4O2/c1-16(21-7-4-14-31-21)23(17-10-12-26-13-11-17)28-20-6-3-2-5-19(20)24(30)29-22-9-8-18(25)15-27-22/h2-9,14-17,23,26,28H,10-13H2,1H3,(H,27,29,30) |
| InChIKey | ZGVSMBSYBUPUTJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |