C23H29ClN4O3 — CID 57228152
methyl 3-[(5-chloro-2-pyridinyl)carbamoyl]-4-(1-piperidin-4-ylbutylamino)benzoate (PubChem CID 57228152) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is methyl 3-[(5-chloro-2-pyridinyl)carbamoyl]-4-(1-piperidin-4-ylbutylamino)benzoate.
| Compound Name | methyl 3-[(5-chloro-2-pyridinyl)carbamoyl]-4-(1-piperidin-4-ylbutylamino)benzoate |
|---|---|
| PubChem CID | 57228152 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | methyl 3-[(5-chloro-2-pyridinyl)carbamoyl]-4-(1-piperidin-4-ylbutylamino)benzoate |
| SMILES | CCCC(Nc1ccc(C(=O)OC)cc1C(=O)Nc1ccc(Cl)cn1)C1CCNCC1 |
| InChI | InChI=1S/C23H29ClN4O3/c1-3-4-19(15-9-11-25-12-10-15)27-20-7-5-16(23(30)31-2)13-18(20)22(29)28-21-8-6-17(24)14-26-21/h5-8,13-15,19,25,27H,3-4,9-12H2,1-2H3,(H,26,28,29) |
| InChIKey | RLWXLOLXEVELHA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |