C17H26N2O4 — CID 54548263
ethyl 2-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methyl]butanoate (PubChem CID 54548263) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is ethyl 2-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methyl]butanoate.
| Compound Name | ethyl 2-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methyl]butanoate |
|---|---|
| PubChem CID | 54548263 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | ethyl 2-[[6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methyl]butanoate |
| SMILES | CCOC(=O)C(CC)Cc1ccc(NC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C17H26N2O4/c1-6-13(15(20)22-7-2)10-12-8-9-14(18-11-12)19-16(21)23-17(3,4)5/h8-9,11,13H,6-7,10H2,1-5H3,(H,18,19,21) |
| InChIKey | ZICIHUFPTOTFJP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |