C15H20N4O — CID 54549412
3-[4-(3-methylbutan-2-yldiazenyl)phenyl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 54549412) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-[4-(3-methylbutan-2-yldiazenyl)phenyl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[4-(3-methylbutan-2-yldiazenyl)phenyl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 54549412 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-[4-(3-methylbutan-2-yldiazenyl)phenyl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC(C)C(C)/N=N/c1ccc(C2=NNC(=O)CC2)cc1 |
| InChI | InChI=1S/C15H20N4O/c1-10(2)11(3)16-17-13-6-4-12(5-7-13)14-8-9-15(20)19-18-14/h4-7,10-11H,8-9H2,1-3H3,(H,19,20)/b17-16+ |
| InChIKey | ZIVMGUXUZFZXAA-WUKNDPDISA-N |
| XLogP | 3.43 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|