C17H19Cl2NO2 — CID 54550055
N-[2-(2,5-dichlorophenoxy)ethyl]-N-ethyl-3-methoxyaniline (PubChem CID 54550055) has the molecular formula C17H19Cl2NO2 and a molecular weight of 340.25 g/mol. Its IUPAC name is N-[2-(2,5-dichlorophenoxy)ethyl]-N-ethyl-3-methoxyaniline.
| Compound Name | N-[2-(2,5-dichlorophenoxy)ethyl]-N-ethyl-3-methoxyaniline |
|---|---|
| PubChem CID | 54550055 |
| Molecular Formula | C17H19Cl2NO2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-[2-(2,5-dichlorophenoxy)ethyl]-N-ethyl-3-methoxyaniline |
| SMILES | CCN(CCOc1cc(Cl)ccc1Cl)c1cccc(OC)c1 |
| InChI | InChI=1S/C17H19Cl2NO2/c1-3-20(14-5-4-6-15(12-14)21-2)9-10-22-17-11-13(18)7-8-16(17)19/h4-8,11-12H,3,9-10H2,1-2H3 |
| InChIKey | ZJGWYYIOCRUMKM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |