C7H12Br2O4S — CID 54551646
2-bromo-3-(bromomethylsulfonyl)-1,4-dimethoxybut-2-ene (PubChem CID 54551646) has the molecular formula C7H12Br2O4S and a molecular weight of 352.04 g/mol. Its IUPAC name is 2-bromo-3-(bromomethylsulfonyl)-1,4-dimethoxybut-2-ene.
| Compound Name | 2-bromo-3-(bromomethylsulfonyl)-1,4-dimethoxybut-2-ene |
|---|---|
| PubChem CID | 54551646 |
| Molecular Formula | C7H12Br2O4S |
| Molecular Weight | 352.04 g/mol |
| Exact Mass | 349.88 |
| IUPAC Name | 2-bromo-3-(bromomethylsulfonyl)-1,4-dimethoxybut-2-ene |
| SMILES | COCC(Br)=C(COC)S(=O)(=O)CBr |
| InChI | InChI=1S/C7H12Br2O4S/c1-12-3-6(9)7(4-13-2)14(10,11)5-8/h3-5H2,1-2H3 |
| InChIKey | ZKHYHJRGYALVQT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.04 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|