C7H13BrO4S — CID 88825340
(E)-2-bromo-1,4-dimethoxy-3-methylsulfonylbut-2-ene (PubChem CID 88825340) has the molecular formula C7H13BrO4S and a molecular weight of 273.15 g/mol. Its IUPAC name is (E)-2-bromo-1,4-dimethoxy-3-methylsulfonylbut-2-ene.
| Compound Name | (E)-2-bromo-1,4-dimethoxy-3-methylsulfonylbut-2-ene |
|---|---|
| PubChem CID | 88825340 |
| Molecular Formula | C7H13BrO4S |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | (E)-2-bromo-1,4-dimethoxy-3-methylsulfonylbut-2-ene |
| SMILES | COC/C(Br)=C(/COC)S(C)(=O)=O |
| InChI | InChI=1S/C7H13BrO4S/c1-11-4-6(8)7(5-12-2)13(3,9)10/h4-5H2,1-3H3/b7-6+ |
| InChIKey | LRIAWBLXNOTVQM-VOTSOKGWSA-N |
| XLogP | 0.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |