C6H10N2O3 — CID 54552922
(2S)-3-hydroxy-2-(prop-2-enoylamino)propanamide (PubChem CID 54552922) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-(prop-2-enoylamino)propanamide.
| Compound Name | (2S)-3-hydroxy-2-(prop-2-enoylamino)propanamide |
|---|---|
| PubChem CID | 54552922 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | (2S)-3-hydroxy-2-(prop-2-enoylamino)propanamide |
| SMILES | C=CC(=O)N[C@@H](CO)C(N)=O |
| InChI | InChI=1S/C6H10N2O3/c1-2-5(10)8-4(3-9)6(7)11/h2,4,9H,1,3H2,(H2,7,11)(H,8,10)/t4-/m0/s1 |
| InChIKey | ZLEADJUJOUVPLP-BYPYZUCNSA-N |
| XLogP | -1.87 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|