C10H13N3O5 — CID 147258650
(2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxy-N-methylpropanamide (PubChem CID 147258650) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxy-N-methylpropanamide.
| Compound Name | (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 147258650 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2S)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-hydroxy-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](CO)NC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H13N3O5/c1-11-10(18)6(5-14)12-7(15)4-13-8(16)2-3-9(13)17/h2-3,6,14H,4-5H2,1H3,(H,11,18)(H,12,15)/t6-/m0/s1 |
| InChIKey | CODAWTSYNLIAJP-LURJTMIESA-N |
| XLogP | -2.87 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|