C9H12N2O4 — CID 118022981
2-(2,5-dioxopyrrol-1-yl)-N-(2-hydroxyethyl)propanamide (PubChem CID 118022981) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-N-(2-hydroxyethyl)propanamide.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 118022981 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-N-(2-hydroxyethyl)propanamide |
| SMILES | CC(C(=O)NCCO)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H12N2O4/c1-6(9(15)10-4-5-12)11-7(13)2-3-8(11)14/h2-3,6,12H,4-5H2,1H3,(H,10,15) |
| InChIKey | CLRRNXCJCNMWTC-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|