C12H15N3O5 — CID 89343202
3-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[(2S)-1-oxopropan-2-yl]amino]ethyl]propanamide (PubChem CID 89343202) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[(2S)-1-oxopropan-2-yl]amino]ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[(2S)-1-oxopropan-2-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 89343202 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[(2S)-1-oxopropan-2-yl]amino]ethyl]propanamide |
| SMILES | C[C@@H](C=O)NC(=O)CNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H15N3O5/c1-8(7-16)14-10(18)6-13-9(17)4-5-15-11(19)2-3-12(15)20/h2-3,7-8H,4-6H2,1H3,(H,13,17)(H,14,18)/t8-/m0/s1 |
| InChIKey | FYVGXIAKJDTGDI-QMMMGPOBSA-N |
| XLogP | -1.88 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|