C13H15N3O4 — CID 59248174
(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-methylpent-4-ynamide (PubChem CID 59248174) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is (2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-methylpent-4-ynamide.
| Compound Name | (2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-methylpent-4-ynamide |
|---|---|
| PubChem CID | 59248174 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-N-methylpent-4-ynamide |
| SMILES | C#CC[C@H](NC(=O)CCN1C(=O)C=CC1=O)C(=O)NC |
| InChI | InChI=1S/C13H15N3O4/c1-3-4-9(13(20)14-2)15-10(17)7-8-16-11(18)5-6-12(16)19/h1,5-6,9H,4,7-8H2,2H3,(H,14,20)(H,15,17)/t9-/m0/s1 |
| InChIKey | PGNAGPKCSOETHD-VIFPVBQESA-N |
| XLogP | -1.44 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|