C22H33N3O7 — CID 175959359
tert-butyl (2S)-2-[[(2R)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-methylpentanoyl]amino]-5-oxopentanoate (PubChem CID 175959359) has the molecular formula C22H33N3O7 and a molecular weight of 451.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2R)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-methylpentanoyl]amino]-5-oxopentanoate.
| Compound Name | tert-butyl (2S)-2-[[(2R)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-methylpentanoyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 175959359 |
| Molecular Formula | C22H33N3O7 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | tert-butyl (2S)-2-[[(2R)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-methylpentanoyl]amino]-5-oxopentanoate |
| SMILES | CC(C)C[C@@H](NC(=O)CCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCC=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33N3O7/c1-14(2)13-16(23-17(27)10-11-25-18(28)8-9-19(25)29)20(30)24-15(7-6-12-26)21(31)32-22(3,4)5/h8-9,12,14-16H,6-7,10-11,13H2,1-5H3,(H,23,27)(H,24,30)/t15-,16+/m0/s1 |
| InChIKey | FULPPKSIYVKLQA-JKSUJKDBSA-N |
| XLogP | 0.64 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|