C31H50N2O8 — CID 165037508
tert-butyl (2S)-2-(3,3-dimethylbutanoylamino)-8-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]-5-oxooctanoate (PubChem CID 165037508) has the molecular formula C31H50N2O8 and a molecular weight of 578.75 g/mol. Its IUPAC name is tert-butyl (2S)-2-(3,3-dimethylbutanoylamino)-8-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]-5-oxooctanoate.
| Compound Name | tert-butyl (2S)-2-(3,3-dimethylbutanoylamino)-8-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]-5-oxooctanoate |
|---|---|
| PubChem CID | 165037508 |
| Molecular Formula | C31H50N2O8 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | tert-butyl (2S)-2-(3,3-dimethylbutanoylamino)-8-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]-5-oxooctanoate |
| SMILES | CC(C)(C)CC(=O)N[C@@H](CCC(=O)CCCOCCCC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H50N2O8/c1-30(2,3)22-26(36)32-25(29(39)41-31(4,5)6)16-15-24(35)14-11-21-40-20-10-13-23(34)12-8-7-9-19-33-27(37)17-18-28(33)38/h17-18,25H,7-16,19-22H2,1-6H3,(H,32,36)/t25-/m0/s1 |
| InChIKey | NXEOJFKRKQSFKB-VWLOTQADSA-N |
| XLogP | 4.23 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|