C24H32N4O6 — CID 156688558
tert-butyl (2S)-2-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]amino]-6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 156688558) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]amino]-6-(2,5-dioxopyrrol-1-yl)hexanoate.
| Compound Name | tert-butyl (2S)-2-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]amino]-6-(2,5-dioxopyrrol-1-yl)hexanoate |
|---|---|
| PubChem CID | 156688558 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | tert-butyl (2S)-2-[[2-[[3-(aminomethyl)benzoyl]amino]acetyl]amino]-6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCCN1C(=O)C=CC1=O)NC(=O)CNC(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C24H32N4O6/c1-24(2,3)34-23(33)18(9-4-5-12-28-20(30)10-11-21(28)31)27-19(29)15-26-22(32)17-8-6-7-16(13-17)14-25/h6-8,10-11,13,18H,4-5,9,12,14-15,25H2,1-3H3,(H,26,32)(H,27,29)/t18-/m0/s1 |
| InChIKey | ARQNJBJZLNZQOH-SFHVURJKSA-N |
| XLogP | 0.80 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|