C21H31N3O7 — CID 153363804
2-[3-[[2-[[(2S)-6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]amino]-2-oxoethyl]carbamoyl]phenoxy]acetic acid (PubChem CID 153363804) has the molecular formula C21H31N3O7 and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-[3-[[2-[[(2S)-6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]amino]-2-oxoethyl]carbamoyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[2-[[(2S)-6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]amino]-2-oxoethyl]carbamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 153363804 |
| Molecular Formula | C21H31N3O7 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 2-[3-[[2-[[(2S)-6-amino-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]amino]-2-oxoethyl]carbamoyl]phenoxy]acetic acid |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCCN)NC(=O)CNC(=O)c1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C21H31N3O7/c1-21(2,3)31-20(29)16(9-4-5-10-22)24-17(25)12-23-19(28)14-7-6-8-15(11-14)30-13-18(26)27/h6-8,11,16H,4-5,9-10,12-13,22H2,1-3H3,(H,23,28)(H,24,25)(H,26,27)/t16-/m0/s1 |
| InChIKey | SVPWHGBDIOTKGW-INIZCTEOSA-N |
| XLogP | 0.84 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|