C8H12N2O4 — CID 4531075
1-(2-hydroxyethyl)-3-(2-hydroxyethylamino)pyrrole-2,5-dione (PubChem CID 4531075) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(2-hydroxyethylamino)pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-(2-hydroxyethylamino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 4531075 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(2-hydroxyethylamino)pyrrole-2,5-dione |
| SMILES | O=C1C=C(NCCO)C(=O)N1CCO |
| InChI | InChI=1S/C8H12N2O4/c11-3-1-9-6-5-7(13)10(2-4-12)8(6)14/h5,9,11-12H,1-4H2 |
| InChIKey | XAPXBUCYYUEHON-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|