C11H14N2O4 — CID 58331311
2-(2,5-dioxopyrrol-1-yl)-N-(2-ethoxyethyl)prop-2-enamide (PubChem CID 58331311) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-N-(2-ethoxyethyl)prop-2-enamide.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-N-(2-ethoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 58331311 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-N-(2-ethoxyethyl)prop-2-enamide |
| SMILES | C=C(C(=O)NCCOCC)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H14N2O4/c1-3-17-7-6-12-11(16)8(2)13-9(14)4-5-10(13)15/h4-5H,2-3,6-7H2,1H3,(H,12,16) |
| InChIKey | XBMDCRZQNLJUMH-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|