C15H23N3O6 — CID 126550203
N-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 126550203) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is N-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | N-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 126550203 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N-[2-[2-[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCC(=O)NCCOCCOCCNC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H23N3O6/c1-2-12(19)16-5-7-23-9-10-24-8-6-17-13(20)11-18-14(21)3-4-15(18)22/h3-4H,2,5-11H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | FAIJIZRCQQFUSZ-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|