C31H46N6O13 — CID 21059338
N',N'-bis[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-methoxyethyl)butanediamide (PubChem CID 21059338) has the molecular formula C31H46N6O13 and a molecular weight of 710.74 g/mol. Its IUPAC name is N',N'-bis[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-methoxyethyl)butanediamide.
| Compound Name | N',N'-bis[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-methoxyethyl)butanediamide |
|---|---|
| PubChem CID | 21059338 |
| Molecular Formula | C31H46N6O13 |
| Molecular Weight | 710.74 g/mol |
| Exact Mass | 710.31 |
| IUPAC Name | N',N'-bis[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-methoxyethyl)butanediamide |
| SMILES | COCCNC(=O)CCC(=O)N(CC(=O)NCCOCCOCCN1C(=O)C=CC1=O)CC(=O)NCCOCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C31H46N6O13/c1-46-13-8-32-24(38)2-3-27(41)35(22-25(39)33-9-14-47-18-20-49-16-11-36-28(42)4-5-29(36)43)23-26(40)34-10-15-48-19-21-50-17-12-37-30(44)6-7-31(37)45/h4-7H,2-3,8-23H2,1H3,(H,32,38)(H,33,39)(H,34,40) |
| InChIKey | NJVYZBSOWINEHM-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 228.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.74 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|