C25H41N5O12 — CID 89222702
N'-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-hydroperoxyethyl)-N'-[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethyl]butanediamide (PubChem CID 89222702) has the molecular formula C25H41N5O12 and a molecular weight of 603.63 g/mol. Its IUPAC name is N'-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-hydroperoxyethyl)-N'-[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethyl]butanediamide.
| Compound Name | N'-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-hydroperoxyethyl)-N'-[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethyl]butanediamide |
|---|---|
| PubChem CID | 89222702 |
| Molecular Formula | C25H41N5O12 |
| Molecular Weight | 603.63 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | N'-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethylamino]-2-oxoethyl]-N-(2-hydroperoxyethyl)-N'-[2-[2-(2-methoxyethoxy)ethylamino]-2-oxoethyl]butanediamide |
| SMILES | COCCOCCNC(=O)CN(CC(=O)NCCOCCOCCN1C(=O)C=CC1=O)C(=O)CCC(=O)NCCOO |
| InChI | InChI=1S/C25H41N5O12/c1-38-14-15-39-10-6-27-21(32)18-29(23(34)3-2-20(31)26-8-12-42-37)19-22(33)28-7-11-40-16-17-41-13-9-30-24(35)4-5-25(30)36/h4-5,37H,2-3,6-19H2,1H3,(H,26,31)(H,27,32)(H,28,33) |
| InChIKey | OKVAUVBSZOJRIW-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 211.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.63 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|