C21H36N4O7 — CID 59987318
4-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-[[2-(methylamino)acetyl]amino]propoxy]ethoxy]ethoxy]propyl]butanamide (PubChem CID 59987318) has the molecular formula C21H36N4O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-[[2-(methylamino)acetyl]amino]propoxy]ethoxy]ethoxy]propyl]butanamide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-[[2-(methylamino)acetyl]amino]propoxy]ethoxy]ethoxy]propyl]butanamide |
|---|---|
| PubChem CID | 59987318 |
| Molecular Formula | C21H36N4O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-[[2-(methylamino)acetyl]amino]propoxy]ethoxy]ethoxy]propyl]butanamide |
| SMILES | CNCC(=O)NCCCOCCOCCOCCCNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H36N4O7/c1-22-17-19(27)24-9-4-12-31-14-16-32-15-13-30-11-3-8-23-18(26)5-2-10-25-20(28)6-7-21(25)29/h6-7,22H,2-5,8-17H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | DKTPXKLXDQUKQJ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|