C16H22N4O7 — CID 59481967
N'-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-N-formyl-2-(propanoylamino)butanediamide (PubChem CID 59481967) has the molecular formula C16H22N4O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is N'-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-N-formyl-2-(propanoylamino)butanediamide.
| Compound Name | N'-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-N-formyl-2-(propanoylamino)butanediamide |
|---|---|
| PubChem CID | 59481967 |
| Molecular Formula | C16H22N4O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N'-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl]-N-formyl-2-(propanoylamino)butanediamide |
| SMILES | CCC(=O)NC(CC(=O)NCCOCCN1C(=O)C=CC1=O)C(=O)NC=O |
| InChI | InChI=1S/C16H22N4O7/c1-2-12(22)19-11(16(26)18-10-21)9-13(23)17-5-7-27-8-6-20-14(24)3-4-15(20)25/h3-4,10-11H,2,5-9H2,1H3,(H,17,23)(H,19,22)(H,18,21,26) |
| InChIKey | ZFVMKAKEMMERNO-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|