C15H20N4O6 — CID 59481930
N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-N-formyl-2-(propanoylamino)butanediamide (PubChem CID 59481930) has the molecular formula C15H20N4O6 and a molecular weight of 352.35 g/mol. Its IUPAC name is N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-N-formyl-2-(propanoylamino)butanediamide.
| Compound Name | N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-N-formyl-2-(propanoylamino)butanediamide |
|---|---|
| PubChem CID | 59481930 |
| Molecular Formula | C15H20N4O6 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N'-[3-(2,5-dioxopyrrol-1-yl)propyl]-N-formyl-2-(propanoylamino)butanediamide |
| SMILES | CCC(=O)NC(CC(=O)NCCCN1C(=O)C=CC1=O)C(=O)NC=O |
| InChI | InChI=1S/C15H20N4O6/c1-2-11(21)18-10(15(25)17-9-20)8-12(22)16-6-3-7-19-13(23)4-5-14(19)24/h4-5,9-10H,2-3,6-8H2,1H3,(H,16,22)(H,18,21)(H,17,20,25) |
| InChIKey | OSUPCKFGPBMRAY-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|