C19H29N5O6 — CID 59552719
2,3-diacetamido-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]hexanamide (PubChem CID 59552719) has the molecular formula C19H29N5O6 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2,3-diacetamido-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]hexanamide.
| Compound Name | 2,3-diacetamido-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]hexanamide |
|---|---|
| PubChem CID | 59552719 |
| Molecular Formula | C19H29N5O6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 2,3-diacetamido-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]hexanamide |
| SMILES | CCCC(NC(C)=O)C(NC(C)=O)C(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H29N5O6/c1-4-5-14(22-12(2)25)18(23-13(3)26)19(30)21-10-9-20-15(27)8-11-24-16(28)6-7-17(24)29/h6-7,14,18H,4-5,8-11H2,1-3H3,(H,20,27)(H,21,30)(H,22,25)(H,23,26) |
| InChIKey | GMIKKFVBVXBZNW-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|