C14H20N3O4PS — CID 20710718
3-(2,5-dioxopyrrol-1-yl)-N-[5-(methylamino)-6-oxo-6-thiophosphorosohexyl]propanamide (PubChem CID 20710718) has the molecular formula C14H20N3O4PS and a molecular weight of 357.37 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[5-(methylamino)-6-oxo-6-thiophosphorosohexyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[5-(methylamino)-6-oxo-6-thiophosphorosohexyl]propanamide |
|---|---|
| PubChem CID | 20710718 |
| Molecular Formula | C14H20N3O4PS |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[5-(methylamino)-6-oxo-6-thiophosphorosohexyl]propanamide |
| SMILES | CNC(CCCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)P=S |
| InChI | InChI=1S/C14H20N3O4PS/c1-15-10(14(21)22-23)4-2-3-8-16-11(18)7-9-17-12(19)5-6-13(17)20/h5-6,10,15H,2-4,7-9H2,1H3,(H,16,18) |
| InChIKey | LHVDQHRHDHTTLB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|