C13H17N3O4PS- — CID 21135496
[6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-1-oxo-1-thiophosphorosohexan-2-yl]azanide (PubChem CID 21135496) has the molecular formula C13H17N3O4PS- and a molecular weight of 342.34 g/mol. Its IUPAC name is [6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-1-oxo-1-thiophosphorosohexan-2-yl]azanide.
| Compound Name | [6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-1-oxo-1-thiophosphorosohexan-2-yl]azanide |
|---|---|
| PubChem CID | 21135496 |
| Molecular Formula | C13H17N3O4PS- |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | [6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-1-oxo-1-thiophosphorosohexan-2-yl]azanide |
| SMILES | [NH-]C(CCCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)P=S |
| InChI | InChI=1S/C13H17N3O4PS/c14-9(13(20)21-22)3-1-2-7-15-10(17)6-8-16-11(18)4-5-12(16)19/h4-5,9,14H,1-3,6-8H2,(H,15,17)/q-1 |
| InChIKey | SLLAUFWCASWKJE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|