C13H18N3O4PS — CID 21135497
N-(5-amino-6-oxo-6-thiophosphorosohexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 21135497) has the molecular formula C13H18N3O4PS and a molecular weight of 343.35 g/mol. Its IUPAC name is N-(5-amino-6-oxo-6-thiophosphorosohexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-(5-amino-6-oxo-6-thiophosphorosohexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 21135497 |
| Molecular Formula | C13H18N3O4PS |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(5-amino-6-oxo-6-thiophosphorosohexyl)-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | NC(CCCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)P=S |
| InChI | InChI=1S/C13H18N3O4PS/c14-9(13(20)21-22)3-1-2-7-15-10(17)6-8-16-11(18)4-5-12(16)19/h4-5,9H,1-3,6-8,14H2,(H,15,17) |
| InChIKey | FNBFBDANYKEGBD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|