C16H24N4O5 — CID 21299471
6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-(2-oxopropylamino)hexanamide (PubChem CID 21299471) has the molecular formula C16H24N4O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-(2-oxopropylamino)hexanamide.
| Compound Name | 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-(2-oxopropylamino)hexanamide |
|---|---|
| PubChem CID | 21299471 |
| Molecular Formula | C16H24N4O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2-(2-oxopropylamino)hexanamide |
| SMILES | CC(=O)CNC(CCCCNC(=O)CCN1C(=O)C=CC1=O)C(N)=O |
| InChI | InChI=1S/C16H24N4O5/c1-11(21)10-19-12(16(17)25)4-2-3-8-18-13(22)7-9-20-14(23)5-6-15(20)24/h5-6,12,19H,2-4,7-10H2,1H3,(H2,17,25)(H,18,22) |
| InChIKey | JNRAUVRGEGEDPP-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|