C29H36N8O12 — CID 59481957
N,N'-bis[4-[3-(2,5-dioxopyrrol-1-yl)propylamino]-1-formamido-1,4-dioxobutan-2-yl]pentanediamide (PubChem CID 59481957) has the molecular formula C29H36N8O12 and a molecular weight of 688.65 g/mol. Its IUPAC name is N,N'-bis[4-[3-(2,5-dioxopyrrol-1-yl)propylamino]-1-formamido-1,4-dioxobutan-2-yl]pentanediamide.
| Compound Name | N,N'-bis[4-[3-(2,5-dioxopyrrol-1-yl)propylamino]-1-formamido-1,4-dioxobutan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 59481957 |
| Molecular Formula | C29H36N8O12 |
| Molecular Weight | 688.65 g/mol |
| Exact Mass | 688.25 |
| IUPAC Name | N,N'-bis[4-[3-(2,5-dioxopyrrol-1-yl)propylamino]-1-formamido-1,4-dioxobutan-2-yl]pentanediamide |
| SMILES | O=CNC(=O)C(CC(=O)NCCCN1C(=O)C=CC1=O)NC(=O)CCCC(=O)NC(CC(=O)NCCCN1C(=O)C=CC1=O)C(=O)NC=O |
| InChI | InChI=1S/C29H36N8O12/c38-16-32-28(48)18(14-22(42)30-10-2-12-36-24(44)6-7-25(36)45)34-20(40)4-1-5-21(41)35-19(29(49)33-17-39)15-23(43)31-11-3-13-37-26(46)8-9-27(37)47/h6-9,16-19H,1-5,10-15H2,(H,30,42)(H,31,43)(H,34,40)(H,35,41)(H,32,38,48)(H,33,39,49) |
| InChIKey | ZQRBRQDCJDXPPM-UHFFFAOYSA-N |
| XLogP | -4.69 |
| TPSA | 283.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.65 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|