C28H39N7O9 — CID 59197752
N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(pentanoylamino)pentanediamide (PubChem CID 59197752) has the molecular formula C28H39N7O9 and a molecular weight of 617.66 g/mol. Its IUPAC name is N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(pentanoylamino)pentanediamide.
| Compound Name | N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(pentanoylamino)pentanediamide |
|---|---|
| PubChem CID | 59197752 |
| Molecular Formula | C28H39N7O9 |
| Molecular Weight | 617.66 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | N,N'-bis[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]-3-(pentanoylamino)pentanediamide |
| SMILES | CCCCC(=O)NC(CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O)CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C28H39N7O9/c1-2-3-4-22(38)33-19(17-23(39)31-13-11-29-20(36)9-15-34-25(41)5-6-26(34)42)18-24(40)32-14-12-30-21(37)10-16-35-27(43)7-8-28(35)44/h5-8,19H,2-4,9-18H2,1H3,(H,29,36)(H,30,37)(H,31,39)(H,32,40)(H,33,38) |
| InChIKey | CUQMUEFODYFRJC-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 220.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.66 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|