C22H35N3O9 — CID 58253076
N-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexyl]-2-[[2-(2-methoxyethoxy)acetyl]-[2-(2-methoxyethoxy)ethyl]amino]acetamide (PubChem CID 58253076) has the molecular formula C22H35N3O9 and a molecular weight of 485.53 g/mol. Its IUPAC name is N-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexyl]-2-[[2-(2-methoxyethoxy)acetyl]-[2-(2-methoxyethoxy)ethyl]amino]acetamide.
| Compound Name | N-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexyl]-2-[[2-(2-methoxyethoxy)acetyl]-[2-(2-methoxyethoxy)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 58253076 |
| Molecular Formula | C22H35N3O9 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | N-[6-(2,5-dioxopyrrol-1-yl)-4-oxohexyl]-2-[[2-(2-methoxyethoxy)acetyl]-[2-(2-methoxyethoxy)ethyl]amino]acetamide |
| SMILES | COCCOCCN(CC(=O)NCCCC(=O)CCN1C(=O)C=CC1=O)C(=O)COCCOC |
| InChI | InChI=1S/C22H35N3O9/c1-31-12-14-33-11-10-24(22(30)17-34-15-13-32-2)16-19(27)23-8-3-4-18(26)7-9-25-20(28)5-6-21(25)29/h5-6H,3-4,7-17H2,1-2H3,(H,23,27) |
| InChIKey | KMFKNOCBESSEMU-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|