C19H31N3O8 — CID 126558194
2-methoxyethyl N-[2-[2-[2-[[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl]amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 126558194) has the molecular formula C19H31N3O8 and a molecular weight of 429.47 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-[2-[2-[[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl]amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | 2-methoxyethyl N-[2-[2-[2-[[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl]amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 126558194 |
| Molecular Formula | C19H31N3O8 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-methoxyethyl N-[2-[2-[2-[[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl]amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | COCCOC(=O)NCCOCCOCCNCC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H31N3O8/c1-27-11-14-30-19(26)21-7-10-29-13-12-28-9-6-20-15-16(23)3-2-8-22-17(24)4-5-18(22)25/h4-5,20H,2-3,6-15H2,1H3,(H,21,26) |
| InChIKey | NRFFLFIVXAJRBZ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|