C21H34N4O9 — CID 135251971
3-(2,5-dioxopyrrol-1-yl)-N-[2-[[2-[[2-(2-methoxyethoxy)acetyl]-[2-(2-methoxyethoxy)ethyl]amino]acetyl]amino]ethyl]propanamide (PubChem CID 135251971) has the molecular formula C21H34N4O9 and a molecular weight of 486.52 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[[2-[[2-(2-methoxyethoxy)acetyl]-[2-(2-methoxyethoxy)ethyl]amino]acetyl]amino]ethyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[[2-[[2-(2-methoxyethoxy)acetyl]-[2-(2-methoxyethoxy)ethyl]amino]acetyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 135251971 |
| Molecular Formula | C21H34N4O9 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[[2-[[2-(2-methoxyethoxy)acetyl]-[2-(2-methoxyethoxy)ethyl]amino]acetyl]amino]ethyl]propanamide |
| SMILES | COCCOCCN(CC(=O)NCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)COCCOC |
| InChI | InChI=1S/C21H34N4O9/c1-31-11-13-33-10-9-24(21(30)16-34-14-12-32-2)15-18(27)23-7-6-22-17(26)5-8-25-19(28)3-4-20(25)29/h3-4H,5-16H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | HMDOCYMCNANLSX-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|