C12H19N3O5 — CID 21299428
N-(2-aminoethyl)-2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetamide (PubChem CID 21299428) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetamide.
| Compound Name | N-(2-aminoethyl)-2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 21299428 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetamide |
| SMILES | NCCNC(=O)COCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H19N3O5/c13-3-4-14-10(16)9-20-8-7-19-6-5-15-11(17)1-2-12(15)18/h1-2H,3-9,13H2,(H,14,16) |
| InChIKey | MZQKSTUKFHQTHI-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|