C10H14N2O5 — CID 18339262
N-[(2,5-dioxopyrrol-1-yl)methyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 18339262) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is N-[(2,5-dioxopyrrol-1-yl)methyl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[(2,5-dioxopyrrol-1-yl)methyl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 18339262 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[(2,5-dioxopyrrol-1-yl)methyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H14N2O5/c1-16-4-5-17-6-8(13)11-7-12-9(14)2-3-10(12)15/h2-3H,4-7H2,1H3,(H,11,13) |
| InChIKey | PLJHWIGVHSMXJW-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|