C10H14N2O5 — CID 69116680
2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetamide (PubChem CID 69116680) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetamide.
| Compound Name | 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 69116680 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetamide |
| SMILES | NC(=O)COCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H14N2O5/c11-8(13)7-17-6-5-16-4-3-12-9(14)1-2-10(12)15/h1-2H,3-7H2,(H2,11,13) |
| InChIKey | RHIJZTQUWSWATG-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|